C20H26ClN3O — CID 109215470
4-[2-(4-chlorophenyl)ethylamino]-N,N-dipropylpyridine-2-carboxamide (PubChem CID 109215470) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethylamino]-N,N-dipropylpyridine-2-carboxamide.
| Compound Name | 4-[2-(4-chlorophenyl)ethylamino]-N,N-dipropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109215470 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethylamino]-N,N-dipropylpyridine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(NCCc2ccc(Cl)cc2)ccn1 |
| InChI | InChI=1S/C20H26ClN3O/c1-3-13-24(14-4-2)20(25)19-15-18(10-12-23-19)22-11-9-16-5-7-17(21)8-6-16/h5-8,10,12,15H,3-4,9,11,13-14H2,1-2H3,(H,22,23) |
| InChIKey | CENDWGOUFFGEMZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |