C18H24N4O — CID 109213420
N,N-dipropyl-4-(pyridin-4-ylmethylamino)pyridine-2-carboxamide (PubChem CID 109213420) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N,N-dipropyl-4-(pyridin-4-ylmethylamino)pyridine-2-carboxamide.
| Compound Name | N,N-dipropyl-4-(pyridin-4-ylmethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109213420 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N,N-dipropyl-4-(pyridin-4-ylmethylamino)pyridine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(NCc2ccncc2)ccn1 |
| InChI | InChI=1S/C18H24N4O/c1-3-11-22(12-4-2)18(23)17-13-16(7-10-20-17)21-14-15-5-8-19-9-6-15/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,20,21) |
| InChIKey | RSDDUSOUCPZSIY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |