C21H26N4O3 — CID 109090505
2-N-(3-acetamidophenyl)-4-N,4-N-dipropylpyridine-2,4-dicarboxamide (PubChem CID 109090505) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-N-(3-acetamidophenyl)-4-N,4-N-dipropylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(3-acetamidophenyl)-4-N,4-N-dipropylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109090505 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-N-(3-acetamidophenyl)-4-N,4-N-dipropylpyridine-2,4-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccnc(C(=O)Nc2cccc(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C21H26N4O3/c1-4-11-25(12-5-2)21(28)16-9-10-22-19(13-16)20(27)24-18-8-6-7-17(14-18)23-15(3)26/h6-10,13-14H,4-5,11-12H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | PYEYXBZTHREMOI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |