C22H28N4O2 — CID 109078164
2-N-[4-(4-methylpiperidin-1-yl)phenyl]-4-N-propan-2-ylpyridine-2,4-dicarboxamide (PubChem CID 109078164) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-N-[4-(4-methylpiperidin-1-yl)phenyl]-4-N-propan-2-ylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[4-(4-methylpiperidin-1-yl)phenyl]-4-N-propan-2-ylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109078164 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-N-[4-(4-methylpiperidin-1-yl)phenyl]-4-N-propan-2-ylpyridine-2,4-dicarboxamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3cc(C(=O)NC(C)C)ccn3)cc2)CC1 |
| InChI | InChI=1S/C22H28N4O2/c1-15(2)24-21(27)17-8-11-23-20(14-17)22(28)25-18-4-6-19(7-5-18)26-12-9-16(3)10-13-26/h4-8,11,14-16H,9-10,12-13H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | MPBHQTGFLDOUHI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|