C22H28N4O2 — CID 109206689
N-[4-(4-methylpiperidin-1-yl)phenyl]-4-morpholin-4-ylpyridine-2-carboxamide (PubChem CID 109206689) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)phenyl]-4-morpholin-4-ylpyridine-2-carboxamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)phenyl]-4-morpholin-4-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109206689 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)phenyl]-4-morpholin-4-ylpyridine-2-carboxamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3cc(N4CCOCC4)ccn3)cc2)CC1 |
| InChI | InChI=1S/C22H28N4O2/c1-17-7-10-25(11-8-17)19-4-2-18(3-5-19)24-22(27)21-16-20(6-9-23-21)26-12-14-28-15-13-26/h2-6,9,16-17H,7-8,10-15H2,1H3,(H,24,27) |
| InChIKey | YSGKSZKHMMCZAG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|