C23H30N4O2 — CID 109079331
4-N-butyl-2-N-[4-(4-methylpiperidin-1-yl)phenyl]pyridine-2,4-dicarboxamide (PubChem CID 109079331) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-N-butyl-2-N-[4-(4-methylpiperidin-1-yl)phenyl]pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-butyl-2-N-[4-(4-methylpiperidin-1-yl)phenyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109079331 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 4-N-butyl-2-N-[4-(4-methylpiperidin-1-yl)phenyl]pyridine-2,4-dicarboxamide |
| SMILES | CCCCNC(=O)c1ccnc(C(=O)Nc2ccc(N3CCC(C)CC3)cc2)c1 |
| InChI | InChI=1S/C23H30N4O2/c1-3-4-12-25-22(28)18-9-13-24-21(16-18)23(29)26-19-5-7-20(8-6-19)27-14-10-17(2)11-15-27/h5-9,13,16-17H,3-4,10-12,14-15H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | JRJLFGQVEDSNJA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|