C17H16Cl2N4O2 — CID 109154974
N-(2,3-dichlorophenyl)-6-(4-formylpiperazin-1-yl)pyridine-3-carboxamide (PubChem CID 109154974) has the molecular formula C17H16Cl2N4O2 and a molecular weight of 379.25 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-6-(4-formylpiperazin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-6-(4-formylpiperazin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109154974 |
| Molecular Formula | C17H16Cl2N4O2 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-(2,3-dichlorophenyl)-6-(4-formylpiperazin-1-yl)pyridine-3-carboxamide |
| SMILES | O=CN1CCN(c2ccc(C(=O)Nc3cccc(Cl)c3Cl)cn2)CC1 |
| InChI | InChI=1S/C17H16Cl2N4O2/c18-13-2-1-3-14(16(13)19)21-17(25)12-4-5-15(20-10-12)23-8-6-22(11-24)7-9-23/h1-5,10-11H,6-9H2,(H,21,25) |
| InChIKey | HLXYWKDWDFMNIF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|