C16H15Cl2N5O2 — CID 109116912
N-(2,3-dichlorophenyl)-6-(4-formylpiperazin-1-yl)pyridazine-3-carboxamide (PubChem CID 109116912) has the molecular formula C16H15Cl2N5O2 and a molecular weight of 380.24 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-6-(4-formylpiperazin-1-yl)pyridazine-3-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-6-(4-formylpiperazin-1-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109116912 |
| Molecular Formula | C16H15Cl2N5O2 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-(2,3-dichlorophenyl)-6-(4-formylpiperazin-1-yl)pyridazine-3-carboxamide |
| SMILES | O=CN1CCN(c2ccc(C(=O)Nc3cccc(Cl)c3Cl)nn2)CC1 |
| InChI | InChI=1S/C16H15Cl2N5O2/c17-11-2-1-3-12(15(11)18)19-16(25)13-4-5-14(21-20-13)23-8-6-22(10-24)7-9-23/h1-5,10H,6-9H2,(H,19,25) |
| InChIKey | DHCPBPBRDMORIH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|