C21H26ClN3O3 — CID 5021302
N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3,4-dimethoxybenzamide (PubChem CID 5021302) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 5021302 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3,4-dimethoxybenzamide |
| SMILES | CCN1CCN(c2c(Cl)cccc2NC(=O)c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C21H26ClN3O3/c1-4-24-10-12-25(13-11-24)20-16(22)6-5-7-17(20)23-21(26)15-8-9-18(27-2)19(14-15)28-3/h5-9,14H,4,10-13H2,1-3H3,(H,23,26) |
| InChIKey | AADVQVPUYRRSPL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |