C25H31N3OS — CID 22777662
(E)-N-[[4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 22777662) has the molecular formula C25H31N3OS and a molecular weight of 421.61 g/mol. Its IUPAC name is (E)-N-[[4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 22777662 |
| Molecular Formula | C25H31N3OS |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | (E)-N-[[4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC1CCN(c2ccc(NC(=S)NC(=O)/C=C/c3ccc(C(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H31N3OS/c1-18(2)21-7-4-20(5-8-21)6-13-24(29)27-25(30)26-22-9-11-23(12-10-22)28-16-14-19(3)15-17-28/h4-13,18-19H,14-17H2,1-3H3,(H2,26,27,29,30)/b13-6+ |
| InChIKey | IZHSZWPRPHUMKB-AWNIVKPZSA-N |
| XLogP | 5.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|