C19H18ClF4N3O3 — CID 172895118
2-chloro-4-fluoro-N-(4-piperazin-1-ylphenyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 172895118) has the molecular formula C19H18ClF4N3O3 and a molecular weight of 447.82 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-(4-piperazin-1-ylphenyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-chloro-4-fluoro-N-(4-piperazin-1-ylphenyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172895118 |
| Molecular Formula | C19H18ClF4N3O3 |
| Molecular Weight | 447.82 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 2-chloro-4-fluoro-N-(4-piperazin-1-ylphenyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccc(N2CCNCC2)cc1)c1ccc(F)cc1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H17ClFN3O.C2HF3O2/c18-16-11-12(19)1-6-15(16)17(23)21-13-2-4-14(5-3-13)22-9-7-20-8-10-22;3-2(4,5)1(6)7/h1-6,11,20H,7-10H2,(H,21,23);(H,6,7) |
| InChIKey | HNFDLMSQJSLNLI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|