C19H17F3N4O4 — CID 17050169
2-nitro-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17050169) has the molecular formula C19H17F3N4O4 and a molecular weight of 422.36 g/mol. Its IUPAC name is 2-nitro-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 2-nitro-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17050169 |
| Molecular Formula | C19H17F3N4O4 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-nitro-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)C(F)(F)F)CC2)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17F3N4O4/c20-19(21,22)18(28)25-11-9-24(10-12-25)14-7-5-13(6-8-14)23-17(27)15-3-1-2-4-16(15)26(29)30/h1-8H,9-12H2,(H,23,27) |
| InChIKey | QJRPKEVVHSRNAX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|