C21H32N2O3 — CID 55659359
4-tert-butyl-N-[3-methyl-1-oxo-1-(oxolan-3-ylmethylamino)butan-2-yl]benzamide (PubChem CID 55659359) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-methyl-1-oxo-1-(oxolan-3-ylmethylamino)butan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-methyl-1-oxo-1-(oxolan-3-ylmethylamino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 55659359 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 4-tert-butyl-N-[3-methyl-1-oxo-1-(oxolan-3-ylmethylamino)butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)NCC1CCOC1 |
| InChI | InChI=1S/C21H32N2O3/c1-14(2)18(20(25)22-12-15-10-11-26-13-15)23-19(24)16-6-8-17(9-7-16)21(3,4)5/h6-9,14-15,18H,10-13H2,1-5H3,(H,22,25)(H,23,24) |
| InChIKey | MMBUZZOFFWJSGP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |