C23H36N2O4 — CID 86971626
N-[1-[(2-tert-butyloxan-3-yl)methylamino]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide (PubChem CID 86971626) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is N-[1-[(2-tert-butyloxan-3-yl)methylamino]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide.
| Compound Name | N-[1-[(2-tert-butyloxan-3-yl)methylamino]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 86971626 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | N-[1-[(2-tert-butyloxan-3-yl)methylamino]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(C(=O)NCC2CCCOC2C(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C23H36N2O4/c1-15(2)19(25-21(26)16-9-11-18(28-6)12-10-16)22(27)24-14-17-8-7-13-29-20(17)23(3,4)5/h9-12,15,17,19-20H,7-8,13-14H2,1-6H3,(H,24,27)(H,25,26) |
| InChIKey | FKWUTWDXXSJKMQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |