C22H36N3O3+ — CID 9472900
4-methoxy-N-[(2S)-3-methyl-1-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propylamino]-1-oxobutan-2-yl]benzamide (PubChem CID 9472900) has the molecular formula C22H36N3O3+ and a molecular weight of 390.55 g/mol. Its IUPAC name is 4-methoxy-N-[(2S)-3-methyl-1-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propylamino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[(2S)-3-methyl-1-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propylamino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 9472900 |
| Molecular Formula | C22H36N3O3+ |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 4-methoxy-N-[(2S)-3-methyl-1-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propylamino]-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H](C(=O)NCCC[NH+]2CCCC[C@@H]2C)C(C)C)cc1 |
| InChI | InChI=1S/C22H35N3O3/c1-16(2)20(24-21(26)18-9-11-19(28-4)12-10-18)22(27)23-13-7-15-25-14-6-5-8-17(25)3/h9-12,16-17,20H,5-8,13-15H2,1-4H3,(H,23,27)(H,24,26)/p+1/t17-,20-/m0/s1 |
| InChIKey | SDDHHYDTSDITIX-PXNSSMCTSA-O |
| XLogP | 1.41 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|