C18H25F4NO — CID 91731309
N-decyl-5-fluoro-2-(trifluoromethyl)benzamide (PubChem CID 91731309) has the molecular formula C18H25F4NO and a molecular weight of 347.40 g/mol. Its IUPAC name is N-decyl-5-fluoro-2-(trifluoromethyl)benzamide.
| Compound Name | N-decyl-5-fluoro-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91731309 |
| Molecular Formula | C18H25F4NO |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-decyl-5-fluoro-2-(trifluoromethyl)benzamide |
| SMILES | CCCCCCCCCCNC(=O)c1cc(F)ccc1C(F)(F)F |
| InChI | InChI=1S/C18H25F4NO/c1-2-3-4-5-6-7-8-9-12-23-17(24)15-13-14(19)10-11-16(15)18(20,21)22/h10-11,13H,2-9,12H2,1H3,(H,23,24) |
| InChIKey | FXJAKWJSVBTGDM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|