4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid

C13H15F2NO4 — CID 107316553

IUPAC4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid
SMILESO=C(O)c1cc(F)c(F)cc1C(=O)NCCCCCO
InChIInChI=1S/C13H15F2NO4/c14-10-6-8(9(13(19)20)7-11(10)15)12(18)16-4-2-1-3-5-17/h6-7,17H,1-5H2,(H,16,18)(H,19,20)
InChIKeyOITOWSMVPSGLIX-UHFFFAOYSA-N
MW287.26 g/mol
LogP1.56
Rot. Bonds7

About 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid

4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid (PubChem CID 107316553) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid.

Molecular Properties

Compound Name4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid
PubChem CID107316553
Molecular FormulaC13H15F2NO4
Molecular Weight287.26 g/mol
Exact Mass287.10
IUPAC Name4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid
SMILESO=C(O)c1cc(F)c(F)cc1C(=O)NCCCCCO
InChIInChI=1S/C13H15F2NO4/c14-10-6-8(9(13(19)20)7-11(10)15)12(18)16-4-2-1-3-5-17/h6-7,17H,1-5H2,(H,16,18)(H,19,20)
InChIKeyOITOWSMVPSGLIX-UHFFFAOYSA-N
XLogP1.56
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.26
LogP ≤ 51.56
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid?
The IUPAC name of 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid (CID 107316553) is 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid.
What is the SMILES notation for 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid?
The canonical SMILES for 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid is O=C(O)c1cc(F)c(F)cc1C(=O)NCCCCCO.
What is the InChIKey of 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid?
The InChIKey is OITOWSMVPSGLIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO4/c14-10-6-8(9(13(19)20)7-11(10)15)12(18)16-4-2-1-3-5-17/h6-7,17H,1-5H2,(H,16,18)(H,19,20).
What are the key properties of 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid?
4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid has a molecular weight of 287.26 g/mol, XLogP of 1.56, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid is sourced from PubChem (CID 107316553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).