C13H15F2NO4 — CID 107316553
4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid (PubChem CID 107316553) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid.
| Compound Name | 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 107316553 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4,5-difluoro-2-(5-hydroxypentylcarbamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)cc1C(=O)NCCCCCO |
| InChI | InChI=1S/C13H15F2NO4/c14-10-6-8(9(13(19)20)7-11(10)15)12(18)16-4-2-1-3-5-17/h6-7,17H,1-5H2,(H,16,18)(H,19,20) |
| InChIKey | OITOWSMVPSGLIX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|