C12H13F4NOS — CID 107033370
2-fluoro-5-sulfanyl-N-(5,5,5-trifluoropentyl)benzamide (PubChem CID 107033370) has the molecular formula C12H13F4NOS and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-fluoro-5-sulfanyl-N-(5,5,5-trifluoropentyl)benzamide.
| Compound Name | 2-fluoro-5-sulfanyl-N-(5,5,5-trifluoropentyl)benzamide |
|---|---|
| PubChem CID | 107033370 |
| Molecular Formula | C12H13F4NOS |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-fluoro-5-sulfanyl-N-(5,5,5-trifluoropentyl)benzamide |
| SMILES | O=C(NCCCCC(F)(F)F)c1cc(S)ccc1F |
| InChI | InChI=1S/C12H13F4NOS/c13-10-4-3-8(19)7-9(10)11(18)17-6-2-1-5-12(14,15)16/h3-4,7,19H,1-2,5-6H2,(H,17,18) |
| InChIKey | BQWUMFDJOLYQMR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|