C9H9Br2NOS — CID 107962345
2,5-dibromo-N-but-3-enylthiophene-3-carboxamide (PubChem CID 107962345) has the molecular formula C9H9Br2NOS and a molecular weight of 339.05 g/mol. Its IUPAC name is 2,5-dibromo-N-but-3-enylthiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-but-3-enylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 107962345 |
| Molecular Formula | C9H9Br2NOS |
| Molecular Weight | 339.05 g/mol |
| Exact Mass | 336.88 |
| IUPAC Name | 2,5-dibromo-N-but-3-enylthiophene-3-carboxamide |
| SMILES | C=CCCNC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H9Br2NOS/c1-2-3-4-12-9(13)6-5-7(10)14-8(6)11/h2,5H,1,3-4H2,(H,12,13) |
| InChIKey | PEYKLFIKQFYFLV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.05 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|