C9H12Br2N2O3S2 — CID 106339469
2,5-dibromo-N-[2-(dimethylsulfamoyl)ethyl]thiophene-3-carboxamide (PubChem CID 106339469) has the molecular formula C9H12Br2N2O3S2 and a molecular weight of 420.15 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-(dimethylsulfamoyl)ethyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[2-(dimethylsulfamoyl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 106339469 |
| Molecular Formula | C9H12Br2N2O3S2 |
| Molecular Weight | 420.15 g/mol |
| Exact Mass | 417.87 |
| IUPAC Name | 2,5-dibromo-N-[2-(dimethylsulfamoyl)ethyl]thiophene-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H12Br2N2O3S2/c1-13(2)18(15,16)4-3-12-9(14)6-5-7(10)17-8(6)11/h5H,3-4H2,1-2H3,(H,12,14) |
| InChIKey | BQDXEYCMMGBYQR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |