C9H10Br2INOS — CID 107966422
2,5-dibromo-N-(4-iodobutyl)thiophene-3-carboxamide (PubChem CID 107966422) has the molecular formula C9H10Br2INOS and a molecular weight of 466.96 g/mol. Its IUPAC name is 2,5-dibromo-N-(4-iodobutyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(4-iodobutyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107966422 |
| Molecular Formula | C9H10Br2INOS |
| Molecular Weight | 466.96 g/mol |
| Exact Mass | 464.79 |
| IUPAC Name | 2,5-dibromo-N-(4-iodobutyl)thiophene-3-carboxamide |
| SMILES | O=C(NCCCCI)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H10Br2INOS/c10-7-5-6(8(11)15-7)9(14)13-4-2-1-3-12/h5H,1-4H2,(H,13,14) |
| InChIKey | UTQXDHKJGLBWHA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.96 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|