C17H13FN2O2 — CID 110429071
2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)-5-phenylbenzamide (PubChem CID 110429071) has the molecular formula C17H13FN2O2 and a molecular weight of 296.30 g/mol. Its IUPAC name is 2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)-5-phenylbenzamide.
| Compound Name | 2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)-5-phenylbenzamide |
|---|---|
| PubChem CID | 110429071 |
| Molecular Formula | C17H13FN2O2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)-5-phenylbenzamide |
| SMILES | Cc1cc(NC(=O)c2cc(-c3ccccc3)ccc2F)no1 |
| InChI | InChI=1S/C17H13FN2O2/c1-11-9-16(20-22-11)19-17(21)14-10-13(7-8-15(14)18)12-5-3-2-4-6-12/h2-10H,1H3,(H,19,20,21) |
| InChIKey | FITHDLLAXWEWPN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |