C11H9FN2O2 — CID 62904514
2-fluoro-5-methyl-N-(1,2-oxazol-4-yl)benzamide (PubChem CID 62904514) has the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-(1,2-oxazol-4-yl)benzamide.
| Compound Name | 2-fluoro-5-methyl-N-(1,2-oxazol-4-yl)benzamide |
|---|---|
| PubChem CID | 62904514 |
| Molecular Formula | C11H9FN2O2 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-fluoro-5-methyl-N-(1,2-oxazol-4-yl)benzamide |
| SMILES | Cc1ccc(F)c(C(=O)Nc2cnoc2)c1 |
| InChI | InChI=1S/C11H9FN2O2/c1-7-2-3-10(12)9(4-7)11(15)14-8-5-13-16-6-8/h2-6H,1H3,(H,14,15) |
| InChIKey | RYIPJGVEPCBKMO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |