C11H10BrN3O2 — CID 112555233
N-(5-amino-3-methyl-2-pyridinyl)-5-bromofuran-2-carboxamide (PubChem CID 112555233) has the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. Its IUPAC name is N-(5-amino-3-methyl-2-pyridinyl)-5-bromofuran-2-carboxamide.
| Compound Name | N-(5-amino-3-methyl-2-pyridinyl)-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 112555233 |
| Molecular Formula | C11H10BrN3O2 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | N-(5-amino-3-methyl-2-pyridinyl)-5-bromofuran-2-carboxamide |
| SMILES | Cc1cc(N)cnc1NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H10BrN3O2/c1-6-4-7(13)5-14-10(6)15-11(16)8-2-3-9(12)17-8/h2-5H,13H2,1H3,(H,14,15,16) |
| InChIKey | ITIOYYFESQNTOU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |