C15H17ClN2O — CID 170900117
2-amino-N-(2,4-dimethylphenyl)benzamide;hydrochloride (PubChem CID 170900117) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is 2-amino-N-(2,4-dimethylphenyl)benzamide;hydrochloride.
| Compound Name | 2-amino-N-(2,4-dimethylphenyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 170900117 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-amino-N-(2,4-dimethylphenyl)benzamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)c2ccccc2N)c(C)c1.Cl |
| InChI | InChI=1S/C15H16N2O.ClH/c1-10-7-8-14(11(2)9-10)17-15(18)12-5-3-4-6-13(12)16;/h3-9H,16H2,1-2H3,(H,17,18);1H |
| InChIKey | WYODQZCVQKBNQS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|