C17H17NO3 — CID 3361206
[2-[(2,5-dimethylphenyl)carbamoyl]phenyl] acetate (PubChem CID 3361206) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is [2-[(2,5-dimethylphenyl)carbamoyl]phenyl] acetate.
| Compound Name | [2-[(2,5-dimethylphenyl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 3361206 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | [2-[(2,5-dimethylphenyl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C17H17NO3/c1-11-8-9-12(2)15(10-11)18-17(20)14-6-4-5-7-16(14)21-13(3)19/h4-10H,1-3H3,(H,18,20) |
| InChIKey | NIRQRKPQRFYKAS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|