About [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane
[2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane (PubChem CID 142951168) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane.
Molecular Properties
| Compound Name | [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane |
| PubChem CID | 142951168 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane |
| SMILES | CC.CC(=O)Oc1ccccc1C(=O)Nc1ccc(C)cc1C#N |
| InChI | InChI=1S/C17H14N2O3.C2H6/c1-11-7-8-15(13(9-11)10-18)19-17(21)14-5-3-4-6-16(14)22-12(2)20;1-2/h3-9H,1-2H3,(H,19,21);1-2H3 |
| InChIKey | AZCCAQQPRCABTP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane?
The IUPAC name of [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane (CID 142951168) is [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane.
What is the SMILES notation for [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane?
The canonical SMILES for [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane is CC.CC(=O)Oc1ccccc1C(=O)Nc1ccc(C)cc1C#N.
What is the InChIKey of [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane?
The InChIKey is AZCCAQQPRCABTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3.C2H6/c1-11-7-8-15(13(9-11)10-18)19-17(21)14-5-3-4-6-16(14)22-12(2)20;1-2/h3-9H,1-2H3,(H,19,21);1-2H3.
What are the key properties of [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane?
[2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane has a molecular weight of 324.38 g/mol, XLogP of 4.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-cyano-4-methylphenyl)carbamoyl]phenyl] acetate;ethane is sourced from PubChem (CID 142951168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).