C17H21N3O2 — CID 168594170
3-[2-(N-anilino-C-methylcarbonimidoyl)anilino]propane-1,2-diol (PubChem CID 168594170) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-[2-(N-anilino-C-methylcarbonimidoyl)anilino]propane-1,2-diol.
| Compound Name | 3-[2-(N-anilino-C-methylcarbonimidoyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168594170 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 3-[2-(N-anilino-C-methylcarbonimidoyl)anilino]propane-1,2-diol |
| SMILES | CC(=NNc1ccccc1)c1ccccc1NCC(O)CO |
| InChI | InChI=1S/C17H21N3O2/c1-13(19-20-14-7-3-2-4-8-14)16-9-5-6-10-17(16)18-11-15(22)12-21/h2-10,15,18,20-22H,11-12H2,1H3 |
| InChIKey | HMMFUGHSXMKYJD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|