C11H16N2O3 — CID 168597437
3-[2-(methoxyiminomethyl)anilino]propane-1,2-diol (PubChem CID 168597437) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-[2-(methoxyiminomethyl)anilino]propane-1,2-diol.
| Compound Name | 3-[2-(methoxyiminomethyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168597437 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-[2-(methoxyiminomethyl)anilino]propane-1,2-diol |
| SMILES | CON=Cc1ccccc1NCC(O)CO |
| InChI | InChI=1S/C11H16N2O3/c1-16-13-6-9-4-2-3-5-11(9)12-7-10(15)8-14/h2-6,10,12,14-15H,7-8H2,1H3 |
| InChIKey | JAHAMXSFRQBGNN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|