C18H17N2O4- — CID 5106256
4-[3-[(2-methylphenyl)carbamoyl]anilino]-4-oxobutanoate (PubChem CID 5106256) has the molecular formula C18H17N2O4- and a molecular weight of 325.34 g/mol. Its IUPAC name is 4-[3-[(2-methylphenyl)carbamoyl]anilino]-4-oxobutanoate.
| Compound Name | 4-[3-[(2-methylphenyl)carbamoyl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 5106256 |
| Molecular Formula | C18H17N2O4- |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-[3-[(2-methylphenyl)carbamoyl]anilino]-4-oxobutanoate |
| SMILES | Cc1ccccc1NC(=O)c1cccc(NC(=O)CCC(=O)[O-])c1 |
| InChI | InChI=1S/C18H18N2O4/c1-12-5-2-3-8-15(12)20-18(24)13-6-4-7-14(11-13)19-16(21)9-10-17(22)23/h2-8,11H,9-10H2,1H3,(H,19,21)(H,20,24)(H,22,23)/p-1 |
| InChIKey | JPNGZTYUIDWKCY-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |