C13H16F3NO4 — CID 168593700
3-[[4-hydroxy-2-(trifluoromethyl)-3,4-dihydro-2H-chromen-6-yl]amino]propane-1,2-diol (PubChem CID 168593700) has the molecular formula C13H16F3NO4 and a molecular weight of 307.27 g/mol. Its IUPAC name is 3-[[4-hydroxy-2-(trifluoromethyl)-3,4-dihydro-2H-chromen-6-yl]amino]propane-1,2-diol.
| Compound Name | 3-[[4-hydroxy-2-(trifluoromethyl)-3,4-dihydro-2H-chromen-6-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 168593700 |
| Molecular Formula | C13H16F3NO4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[[4-hydroxy-2-(trifluoromethyl)-3,4-dihydro-2H-chromen-6-yl]amino]propane-1,2-diol |
| SMILES | OCC(O)CNc1ccc2c(c1)C(O)CC(C(F)(F)F)O2 |
| InChI | InChI=1S/C13H16F3NO4/c14-13(15,16)12-4-10(20)9-3-7(1-2-11(9)21-12)17-5-8(19)6-18/h1-3,8,10,12,17-20H,4-6H2 |
| InChIKey | ISTWKHQAISULFH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|