C11H11F3N2O2S — CID 169360088
[4-hydroxy-2-(trifluoromethyl)-3,4-dihydro-2H-chromen-6-yl]thiourea (PubChem CID 169360088) has the molecular formula C11H11F3N2O2S and a molecular weight of 292.28 g/mol. Its IUPAC name is [4-hydroxy-2-(trifluoromethyl)-3,4-dihydro-2H-chromen-6-yl]thiourea.
| Compound Name | [4-hydroxy-2-(trifluoromethyl)-3,4-dihydro-2H-chromen-6-yl]thiourea |
|---|---|
| PubChem CID | 169360088 |
| Molecular Formula | C11H11F3N2O2S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | [4-hydroxy-2-(trifluoromethyl)-3,4-dihydro-2H-chromen-6-yl]thiourea |
| SMILES | NC(=S)Nc1ccc2c(c1)C(O)CC(C(F)(F)F)O2 |
| InChI | InChI=1S/C11H11F3N2O2S/c12-11(13,14)9-4-7(17)6-3-5(16-10(15)19)1-2-8(6)18-9/h1-3,7,9,17H,4H2,(H3,15,16,19) |
| InChIKey | ZSTPOAMPKJGPDF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|