C10H8ClF3OS — CID 57361832
(2R,4R)-6-chloro-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-4-thiol (PubChem CID 57361832) has the molecular formula C10H8ClF3OS and a molecular weight of 268.69 g/mol. Its IUPAC name is (2R,4R)-6-chloro-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-4-thiol.
| Compound Name | (2R,4R)-6-chloro-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-4-thiol |
|---|---|
| PubChem CID | 57361832 |
| Molecular Formula | C10H8ClF3OS |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | (2R,4R)-6-chloro-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-4-thiol |
| SMILES | FC(F)(F)[C@H]1C[C@@H](S)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C10H8ClF3OS/c11-5-1-2-7-6(3-5)8(16)4-9(15-7)10(12,13)14/h1-3,8-9,16H,4H2/t8-,9-/m1/s1 |
| InChIKey | JSPBSRAYNGAABT-RKDXNWHRSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|