C13H18N2O4 — CID 168597333
7-(2,3-dihydroxypropylamino)-2,4-dimethyl-1,4-benzoxazin-3-one (PubChem CID 168597333) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropylamino)-2,4-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | 7-(2,3-dihydroxypropylamino)-2,4-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 168597333 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 7-(2,3-dihydroxypropylamino)-2,4-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2cc(NCC(O)CO)ccc2N(C)C1=O |
| InChI | InChI=1S/C13H18N2O4/c1-8-13(18)15(2)11-4-3-9(5-12(11)19-8)14-6-10(17)7-16/h3-5,8,10,14,16-17H,6-7H2,1-2H3 |
| InChIKey | OSULZODLHQUZLS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |