C12H17N3O2 — CID 118559373
6-(2-aminoethylamino)-2,2-dimethyl-4H-1,4-benzoxazin-3-one (PubChem CID 118559373) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-(2-aminoethylamino)-2,2-dimethyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-aminoethylamino)-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 118559373 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-(2-aminoethylamino)-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2ccc(NCCN)cc2NC1=O |
| InChI | InChI=1S/C12H17N3O2/c1-12(2)11(16)15-9-7-8(14-6-5-13)3-4-10(9)17-12/h3-4,7,14H,5-6,13H2,1-2H3,(H,15,16) |
| InChIKey | HPXQWKPSMIWUFZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|