C10H8N2O2S — CID 82493989
7-isothiocyanato-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 82493989) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 7-isothiocyanato-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 7-isothiocyanato-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 82493989 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 7-isothiocyanato-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | O=C1CCOc2ccc(N=C=S)cc2N1 |
| InChI | InChI=1S/C10H8N2O2S/c13-10-3-4-14-9-2-1-7(11-6-15)5-8(9)12-10/h1-2,5H,3-4H2,(H,12,13) |
| InChIKey | NOQUGPKTCJSLAQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|