C17H20ClNO — CID 15945335
2-(dimethylamino)-1,3-diphenylpropan-1-one;hydrochloride (PubChem CID 15945335) has the molecular formula C17H20ClNO and a molecular weight of 289.81 g/mol. Its IUPAC name is 2-(dimethylamino)-1,3-diphenylpropan-1-one;hydrochloride.
| Compound Name | 2-(dimethylamino)-1,3-diphenylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 15945335 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-(dimethylamino)-1,3-diphenylpropan-1-one;hydrochloride |
| SMILES | CN(C)C(Cc1ccccc1)C(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C17H19NO.ClH/c1-18(2)16(13-14-9-5-3-6-10-14)17(19)15-11-7-4-8-12-15;/h3-12,16H,13H2,1-2H3;1H |
| InChIKey | KCCSZICFICZUGU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |