C16H12Cl2N4OS — CID 18824087
6-[5-(3,4-dichlorophenyl)furan-2-yl]-3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 18824087) has the molecular formula C16H12Cl2N4OS and a molecular weight of 379.27 g/mol. Its IUPAC name is 6-[5-(3,4-dichlorophenyl)furan-2-yl]-3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[5-(3,4-dichlorophenyl)furan-2-yl]-3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 18824087 |
| Molecular Formula | C16H12Cl2N4OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 6-[5-(3,4-dichlorophenyl)furan-2-yl]-3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CCCc1nnc2sc(-c3ccc(-c4ccc(Cl)c(Cl)c4)o3)nn12 |
| InChI | InChI=1S/C16H12Cl2N4OS/c1-2-3-14-19-20-16-22(14)21-15(24-16)13-7-6-12(23-13)9-4-5-10(17)11(18)8-9/h4-8H,2-3H2,1H3 |
| InChIKey | FYIDNPYHTPYXRK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |