C22H23N5O3S — CID 17176961
2-(2,4-dimethylphenoxy)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]acetamide (PubChem CID 17176961) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]acetamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 17176961 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]acetamide |
| SMILES | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4C)c3)nn12 |
| InChI | InChI=1S/C22H23N5O3S/c1-5-19-24-25-22-27(19)26-21(31-22)15-7-9-18(29-4)16(11-15)23-20(28)12-30-17-8-6-13(2)10-14(17)3/h6-11H,5,12H2,1-4H3,(H,23,28) |
| InChIKey | UCQCRYXPGMDPSS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |