C26H24ClN3O4S — CID 17335768
N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,4-dimethoxybenzamide (PubChem CID 17335768) has the molecular formula C26H24ClN3O4S and a molecular weight of 510.02 g/mol. Its IUPAC name is N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17335768 |
| Molecular Formula | C26H24ClN3O4S |
| Molecular Weight | 510.02 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | N-[[4-chloro-3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(Cl)c(-c3nc4cc(C(C)C)ccc4o3)c2)c(OC)c1 |
| InChI | InChI=1S/C26H24ClN3O4S/c1-14(2)15-5-10-22-21(11-15)29-25(34-22)19-12-16(6-9-20(19)27)28-26(35)30-24(31)18-8-7-17(32-3)13-23(18)33-4/h5-14H,1-4H3,(H2,28,30,31,35) |
| InChIKey | SEVSFRVEDYIWRU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.02 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|