C28H22ClN3O4S — CID 4567355
5-(4-chlorophenyl)-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 4567355) has the molecular formula C28H22ClN3O4S and a molecular weight of 532.02 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4567355 |
| Molecular Formula | C28H22ClN3O4S |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | CCc1ccc2oc(-c3cc(NC(=S)NC(=O)c4ccc(-c5ccc(Cl)cc5)o4)cc(C)c3O)nc2c1 |
| InChI | InChI=1S/C28H22ClN3O4S/c1-3-16-4-9-23-21(13-16)31-27(36-23)20-14-19(12-15(2)25(20)33)30-28(37)32-26(34)24-11-10-22(35-24)17-5-7-18(29)8-6-17/h4-14,33H,3H2,1-2H3,(H2,30,32,34,37) |
| InChIKey | AVPVUIGKTNWGRB-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|