C25H15N5O2S2 — CID 17274838
N-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17274838) has the molecular formula C25H15N5O2S2 and a molecular weight of 481.56 g/mol. Its IUPAC name is N-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17274838 |
| Molecular Formula | C25H15N5O2S2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | N-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3cccc4ccccc34)nc2c1)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C25H15N5O2S2/c31-23(15-8-10-19-20(12-15)30-34-29-19)28-25(33)26-16-9-11-22-21(13-16)27-24(32-22)18-7-3-5-14-4-1-2-6-17(14)18/h1-13H,(H2,26,28,31,33) |
| InChIKey | PVJHQCFROCBOCX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|