C22H15N5O2S2 — CID 17098774
N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17098774) has the molecular formula C22H15N5O2S2 and a molecular weight of 445.53 g/mol. Its IUPAC name is N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17098774 |
| Molecular Formula | C22H15N5O2S2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | Cc1ccc2oc(-c3ccc(NC(=S)NC(=O)c4ccc5nsnc5c4)cc3)nc2c1 |
| InChI | InChI=1S/C22H15N5O2S2/c1-12-2-9-19-18(10-12)24-21(29-19)13-3-6-15(7-4-13)23-22(30)25-20(28)14-5-8-16-17(11-14)27-31-26-16/h2-11H,1H3,(H2,23,25,28,30) |
| InChIKey | PEVROGHCLFMIPQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|