C22H24Cl2N2O3 — CID 57170822
3-(3,4-dichlorophenyl)-N-[4-methoxy-3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]phenyl]prop-2-enamide (PubChem CID 57170822) has the molecular formula C22H24Cl2N2O3 and a molecular weight of 435.35 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[4-methoxy-3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]phenyl]prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[4-methoxy-3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 57170822 |
| Molecular Formula | C22H24Cl2N2O3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[4-methoxy-3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]phenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C=Cc2ccc(Cl)c(Cl)c2)cc1OC[C@@H]1CCCN1C |
| InChI | InChI=1S/C22H24Cl2N2O3/c1-26-11-3-4-17(26)14-29-21-13-16(7-9-20(21)28-2)25-22(27)10-6-15-5-8-18(23)19(24)12-15/h5-10,12-13,17H,3-4,11,14H2,1-2H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | BRRXDBCFPDAFOV-KRWDZBQOSA-N |
| XLogP | 5.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|