C28H40N2O3 — CID 70145513
N-[3-[3-(dipropylamino)propoxy]-4-methoxyphenyl]-3-(4-propylphenyl)prop-2-enamide (PubChem CID 70145513) has the molecular formula C28H40N2O3 and a molecular weight of 452.64 g/mol. Its IUPAC name is N-[3-[3-(dipropylamino)propoxy]-4-methoxyphenyl]-3-(4-propylphenyl)prop-2-enamide.
| Compound Name | N-[3-[3-(dipropylamino)propoxy]-4-methoxyphenyl]-3-(4-propylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 70145513 |
| Molecular Formula | C28H40N2O3 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | N-[3-[3-(dipropylamino)propoxy]-4-methoxyphenyl]-3-(4-propylphenyl)prop-2-enamide |
| SMILES | CCCc1ccc(C=CC(=O)Nc2ccc(OC)c(OCCCN(CCC)CCC)c2)cc1 |
| InChI | InChI=1S/C28H40N2O3/c1-5-9-23-10-12-24(13-11-23)14-17-28(31)29-25-15-16-26(32-4)27(22-25)33-21-8-20-30(18-6-2)19-7-3/h10-17,22H,5-9,18-21H2,1-4H3,(H,29,31) |
| InChIKey | AMWFZGGRPLJISX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|