C26H32N2O3S — CID 70143434
3-(1-benzothiophen-2-yl)-N-[3-[2-(dipropylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide (PubChem CID 70143434) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-N-[3-[2-(dipropylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | 3-(1-benzothiophen-2-yl)-N-[3-[2-(dipropylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70143434 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-N-[3-[2-(dipropylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide |
| SMILES | CCCN(CCC)CCOc1cc(NC(=O)C=Cc2cc3ccccc3s2)ccc1OC |
| InChI | InChI=1S/C26H32N2O3S/c1-4-14-28(15-5-2)16-17-31-24-19-21(10-12-23(24)30-3)27-26(29)13-11-22-18-20-8-6-7-9-25(20)32-22/h6-13,18-19H,4-5,14-17H2,1-3H3,(H,27,29) |
| InChIKey | RECRIYWOURFKFI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|