C24H30Cl2N2O3 — CID 70143968
3-(2,4-dichlorophenyl)-N-[3-[2-(dipropylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide (PubChem CID 70143968) has the molecular formula C24H30Cl2N2O3 and a molecular weight of 465.42 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[3-[2-(dipropylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[3-[2-(dipropylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70143968 |
| Molecular Formula | C24H30Cl2N2O3 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[3-[2-(dipropylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide |
| SMILES | CCCN(CCC)CCOc1cc(NC(=O)C=Cc2ccc(Cl)cc2Cl)ccc1OC |
| InChI | InChI=1S/C24H30Cl2N2O3/c1-4-12-28(13-5-2)14-15-31-23-17-20(9-10-22(23)30-3)27-24(29)11-7-18-6-8-19(25)16-21(18)26/h6-11,16-17H,4-5,12-15H2,1-3H3,(H,27,29) |
| InChIKey | NVUMEQPEOYZYLZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|