C25H34N2O3S — CID 70148826
(E)-N-[3-[2-[cyclohexyl(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 70148826) has the molecular formula C25H34N2O3S and a molecular weight of 442.63 g/mol. Its IUPAC name is (E)-N-[3-[2-[cyclohexyl(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-[2-[cyclohexyl(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 70148826 |
| Molecular Formula | C25H34N2O3S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (E)-N-[3-[2-[cyclohexyl(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2cccs2)cc1OCCN(C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C25H34N2O3S/c1-19(2)27(21-8-5-4-6-9-21)15-16-30-24-18-20(11-13-23(24)29-3)26-25(28)14-12-22-10-7-17-31-22/h7,10-14,17-19,21H,4-6,8-9,15-16H2,1-3H3,(H,26,28)/b14-12+ |
| InChIKey | BPXFAXQRSQDQHE-WYMLVPIESA-N |
| XLogP | 5.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|