C31H38N2O3 — CID 18672530
N-[3-[2-[cyclohexyl(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-2-phenylbenzamide (PubChem CID 18672530) has the molecular formula C31H38N2O3 and a molecular weight of 486.66 g/mol. Its IUPAC name is N-[3-[2-[cyclohexyl(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-2-phenylbenzamide.
| Compound Name | N-[3-[2-[cyclohexyl(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 18672530 |
| Molecular Formula | C31H38N2O3 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | N-[3-[2-[cyclohexyl(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-2-phenylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2-c2ccccc2)cc1OCCN(C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C31H38N2O3/c1-23(2)33(26-14-8-5-9-15-26)20-21-36-30-22-25(18-19-29(30)35-3)32-31(34)28-17-11-10-16-27(28)24-12-6-4-7-13-24/h4,6-7,10-13,16-19,22-23,26H,5,8-9,14-15,20-21H2,1-3H3,(H,32,34) |
| InChIKey | KRIBDEBLZKGLTE-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |