C22H26N2O4 — CID 110602595
2-(cyclohexanecarbonylamino)-N-(3,4-dimethoxyphenyl)benzamide (PubChem CID 110602595) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(cyclohexanecarbonylamino)-N-(3,4-dimethoxyphenyl)benzamide.
| Compound Name | 2-(cyclohexanecarbonylamino)-N-(3,4-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 110602595 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-(cyclohexanecarbonylamino)-N-(3,4-dimethoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2NC(=O)C2CCCCC2)cc1OC |
| InChI | InChI=1S/C22H26N2O4/c1-27-19-13-12-16(14-20(19)28-2)23-22(26)17-10-6-7-11-18(17)24-21(25)15-8-4-3-5-9-15/h6-7,10-15H,3-5,8-9H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | CKCCQXQJPKIGDI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |